Free. Exclusive. Just for you.
Four unique services that make learning easier, faster, and smarter - only on our website.

Worksheet for naming alkanes using IUPAC nomenclature.

IUPAC naming exercise for alkanes with structural formulas of hydrocarbons.

IUPAC naming exercise for alkanes with structural formulas of hydrocarbons.

JPG 1000×1413 68.9 KB Free · Personal Use
Quality Assured by Worksheets Library Team
Reviewed for educational accuracy and age-appropriateness
ID: #835734
⭐
Show Answer Key & Explanations Step-by-step solution for: IUPAC Nomenclature of Alkanes-Part A worksheet
▼
Here are the IUPAC names for each of the hydrocarbons listed in the worksheet.

a)
1. Find the longest chain: The longest continuous carbon chain has 5 carbons (pentane).
2. Number the chain: Number from right to left to give the branches the lowest numbers (positions 2 and 3).
3. Identify substituents: There is a methyl group at position 2 and another at position 3.
4. Name: 2,3-dimethylpentane

b)
1. Find the longest chain: The longest chain is 4 carbons long (butane).
2. Number the chain: Numbering from either side gives methyl groups at positions 2 and 3.
3. Identify substituents: Two methyl groups.
4. Name: 2,3-dimethylbutane

c)
1. Find the longest chain: Trace the path carefully. The longest chain goes from the bottom-left ethyl group, up through the center, and over to the right. This chain is 7 carbons long (heptane).
* Path: $CH_3-CH_2$ (bottom) $\rightarrow CH \rightarrow CH \rightarrow CH(CH_3)_2$ (right end).
2. Number the chain: Start from the right side. This puts substituents at positions 3, 4, and 5. Starting from the bottom would put them at 3, 4, and 5 as well, but alphabetically "ethyl" comes before "methyl", so we want the lower number for ethyl if there's a tie? Actually, let's look closer.
* Right-to-Left numbering: C1-C2(methyl)-C3(central)-C4(central)-C5(ethyl)... wait.
* Let's re-trace the longest chain strictly.
* Option 1: Bottom ethyl to top ethyl: $2 + 1 + 1 + 1 + 2 = 7$ carbons. Substituents: Isopropyl group ($CH(CH_3)_2$) on one carbon, Methyl on another? No, the structure is complex.
* Let's identify the backbone:
* Central bond connects two CHs.
* Left CH is attached to an Ethyl ($CH_2CH_3$) and another Ethyl ($CH_2CH_3$). Wait, looking at image (c):
* Left side: A CH attached to an Ethyl (down) and an Ethyl (left).
* Right side: A CH attached to an Ethyl (up) and an Isopropyl group (right, $CH(CH_3)_2$).
* So the central bond is between two CHs.
* Longest chain search:
* From bottom-left ethyl end to top-right ethyl end: $2 (\text{ethyl}) + 1 (CH) + 1 (CH) + 2 (\text{ethyl}) = 6$ carbons.
* From bottom-left ethyl end to far-right isopropyl end: $2 (\text{ethyl}) + 1 (CH) + 1 (CH) + 1 (CH) + 1 (\text{methyl}) = 6$ carbons.
* From top-left ethyl end... same.
* Let's check the chain going from the far-right isopropyl methyl, through the isopropyl CH, through the central CHs, to the bottom-left ethyl.
* Chain: $CH_3-CH(CH_3)-CH(\text{with ethyl})-CH(\text{with ethyl})-CH_2-CH_3$.
* Length: $1+1+1+1+2 = 6$? No.
* Let's count atoms in the longest straight line visually.
* Start at the rightmost methyl of the isopropyl group: C1.
* Go to the CH of the isopropyl: C2.
* Go to the central CH attached to it: C3.
* Go to the other central CH: C4.
* Go down to the ethyl group: C5, C6.
* Total 6 carbons? Let's try going up to the top ethyl on the right.
* Start bottom left ethyl: C1, C2.
* Up to CH: C3.
* Across to CH: C4.
* Up to ethyl: C5, C6.
* It seems the longest chain is 6 carbons (hexane).
* Let's re-evaluate "longest chain".
* Left side: CH bonded to two ethyls.
* Right side: CH bonded to one ethyl and one isopropyl.
* Connection: The two CHs are bonded.
* Longest path: Start at a methyl of the isopropyl (right), go to isopropyl CH, go to central CH, go to other central CH, go to end of an ethyl group.
* Count: Methyl(1) - CH(2) - CH(3) - CH(4) - CH2(5) - CH3(6).
* So the parent is Hexane.
* Now identify substituents on this hexane chain.
* Numbering: We want lowest locants.
* If we start from the isopropyl end (right):
* C1: Methyl part of isopropyl.
* C2: CH of isopropyl. At C2, there is a Methyl substituent.
* C3: Central CH. Attached to it is an Ethyl group (the one pointing up).
* C4: Other Central CH. Attached to it is an Ethyl group (the one pointing left or down, whichever isn't in the main chain).
* C5-C6: The rest of the chain.
* So substituents are: 2-methyl, 3-ethyl, 4-ethyl.
* Combine ethyls: 3,4-diethyl.
* Alphabetical order: Ethyl before Methyl.
* Name: 3,4-diethyl-2-methylhexane.

d)
1. Find the longest chain: The horizontal chain has 5 carbons. However, if you start from the bottom ethyl group, go up, and go right, you also get 5 carbons. Let's look for longer.
* Bottom ethyl ($CH_3CH_2-$) to Right isopropyl end ($-CH(CH_3)_2$).
* Path: $CH_3-CH_2$ (bottom) $\rightarrow CH \rightarrow CH \rightarrow CH(CH_3)_2$.
* Count: $2 + 1 + 1 + 2 = 6$ carbons. This is longer than the horizontal 5.
* So the parent is Hexane.
2. Number the chain:
* Start from the right (isopropyl end) to give branches lower numbers.
* C1-C2: The isopropyl end (so C2 has a methyl).
* C3: The CH connected to the isopropyl. It has an Ethyl group attached (the horizontal left part $CH_3CH_2-$).
* C4: The CH connected to that. It has an Ethyl group attached (the vertical bottom part).
* C5-C6: The rest of the chain? Wait.
* Let's re-trace carefully.
* Structure:
* Central bond between two CHs.
* Left CH is attached to: Ethyl (left) and Ethyl (down).
* Right CH is attached to: Isopropyl (right). And... nothing else? No, it's $CH-CH(CH_3)_2$.
* Wait, the diagram shows:
$H_3C-CH_2$ (left) attached to a CH.
$H_3C-CH_2$ (down) attached to the SAME CH.
That CH is attached to another CH.
That second CH is attached to a $CH(CH_3)_2$ group? No, it looks like $CH-CH(CH_3)_2$ where the last part is an isopropyl group.
Actually, looking at (d):
Left part: A CH with an ethyl group (left) and an ethyl group (down).
Right part: That CH is bonded to a CH which is bonded to two methyls (an isopropyl group).
So, Longest Chain:
Start at end of one ethyl (2C) -> CH (1C) -> CH (1C) -> CH of isopropyl (1C) -> Methyl (1C).
Total: $2+1+1+1+1 = 6$ carbons. Parent: Hexane.
Numbering:
Start from the right (isopropyl side) to get substituents earlier.
C1: Methyl of isopropyl.
C2: CH of isopropyl. Has a Methyl substituent.
C3: The central CH (right one). Has no substituent? No, it's part of the chain.
C4: The central CH (left one). Has an Ethyl substituent (the one not in the chain).
C5-C6: The rest of the chain (the ethyl group we started counting from? No, we ended at C1).
Let's restart numbering from Right to Left properly.
Chain ends:
End A: Top-right methyl.
End B: Bottom-right methyl.
End C: Left ethyl end.
End D: Down ethyl end.
Path from End A to End C:
C1(Me)-C2(CH)-C3(CH)-C4(CH)-C5(CH2)-C6(CH3).
Substituents on this chain:
At C2: Methyl (the other part of the isopropyl).
At C4: Ethyl (the downward ethyl group).
Positions: 2, 4.
Name: 4-ethyl-2-methylhexane.

e)
1. Find the longest chain: 5 carbons (pentane).
2. Number the chain: Start from the left to give the chlorine the lowest number (position 2).
3. Identify substituents: Chloro group at position 2.
4. Name: 2-chloropentane

f)
1. Find the longest chain:
* Horizontal-ish path: $CH_3-CH_2$ (left) $\rightarrow CH \rightarrow CH \rightarrow CH_2-CH_3$ (right). That's 6 carbons.
* Let's check branches.
* Left CH has a Methyl (down).
* Right CH has an Isopropyl group (up-right, $CH(CH_3)_2$).
* Let's trace the longest path including the isopropyl.
* Start left ethyl end: C1-C2.
* C3: CH with methyl.
* C4: CH with isopropyl.
* From C4, go into isopropyl: C5(CH)-C6(CH3).
* Total length: $2+1+1+1+1 = 6$ carbons.
* Is there a longer one?
* Start right ethyl end: C1-C2.
* C3: CH with isopropyl.
* Into isopropyl: C4-C5.
* Back to C3, go left to C4(CH with methyl), then to ethyl C5-C6.
* Also 6 carbons.
* Let's pick the chain that gives more substituents or simpler names? No, just longest.
* Let's assume the horizontal backbone is the main chain for a moment: Hexane.
* Substituents: 3-methyl, 4-isopropyl?
* If we go *through* the isopropyl, the chain is still 6.
* Let's try to find a 7-carbon chain.
* Left ethyl (2) + CH(1) + CH(1) + Right ethyl (2) = 6.
* Left ethyl (2) + CH(1) + CH(1) + Isopropyl (2) = 6.
* So max length is 6.
* We have two 6-carbon chains.
* Chain 1: Straight across. Substituents: 3-methyl, 4-(1-methylethyl) i.e., isopropyl.
* Chain 2: From left ethyl, through center, up into isopropyl.
* Numbering from left:
* C1-C2 (ethyl).
* C3 (CH): has Methyl.
* C4 (CH): has Ethyl (the right-hand tail).
* C5 (CH of isopropyl): has Methyl.
* C6 (end of isopropyl).
* Substituents: 3-methyl, 4-ethyl, 5-methyl.
* Combined: 3,5-dimethyl-4-ethylhexane.
* Compare Chain 1 vs Chain 2.
* Chain 1 name: 4-isopropyl-3-methylhexane. (Isopropyl is complex).
* Chain 2 name: 4-ethyl-3,5-dimethylhexane. (Simple alkyl groups).
* IUPAC rule: If chains are equal length, choose the one with more substituents.
* Chain 1 has 2 substituents (methyl, isopropyl).
* Chain 2 has 3 substituents (methyl, ethyl, methyl).
* So Chain 2 is the correct parent chain.
* Numbering Chain 2:
* Left-to-Right: 3,5-dimethyl-4-ethyl. Locants: 3,4,5.
* Right-to-Left (starting from isopropyl end):
* C1-C2 (isopropyl part).
* C3 (CH): has Methyl.
* C4 (CH): has Ethyl.
* C5 (CH): has Methyl.
* C6-C7? No, C6 is end of ethyl.
* Locants: 3,4,5.
* Tie in locants. Use alphabetical order to decide numbering direction?
* Substituents: Ethyl, Dimethyl.
* Alphabetical: Ethyl vs Methyl. E comes before M.
* We want the lower number for Ethyl.
* Left-to-Right: Ethyl is at 4.
* Right-to-Left: Ethyl is at 4.
* It's a symmetrical situation regarding the ethyl position.
* Let's check the name construction: 4-ethyl-3,5-dimethylhexane.

g)
1. Find the longest chain:
* Main horizontal zigzag: 8 carbons? Let's count.
* Left ethyl (2) + CH + CH + CH + Propyl (3)?
* Let's trace:
* Far left: Ethyl group ($CH_3CH_2-$).
* Attached to CH (with Methyl down).
* Attached to CH (with Ethyl up).
* Attached to CH (with Br down).
* Attached to Propyl ($CH_2CH_2CH_3$).
* Longest chain path: Left end to Right end.
* Count: $2 (\text{left}) + 1 + 1 + 1 + 3 (\text{right}) = 8$ carbons.
* Parent: Octane.
2. Number the chain:
* Left-to-Right:
* C1-C2: Ethyl part.
* C3: CH with Methyl.
* C4: CH with Ethyl.
* C5: CH with Bromo.
* C6-C8: Propyl part.
* Substituents at: 3, 4, 5.
* Right-to-Left:
* C1-C3: Propyl part.
* C4: CH with Bromo.
* C5: CH with Ethyl.
* C6: CH with Methyl.
* Substituents at: 4, 5, 6.
* Lower locants win: 3,4,5 is better than 4,5,6. So number from Left.
3. Assemble Name:
* Substituents: Bromo, Ethyl, Methyl.
* Alphabetical order: Bromo, Ethyl, Methyl.
* Positions: 5-Bromo, 4-Ethyl, 3-Methyl.
* Name: 5-bromo-4-ethyl-3-methyloctane.

h)
Formula: $CH_3CH_2C(CH_3)_2CH_2CH(F)CH(CH_2CH_3)CH_3$
Let's expand the structure to find the longest chain.
1. Expand:
* $C^1H_3-C^2H_2-$
* $-C^3(CH_3)_2-$ (Quaternary carbon with two methyls)
* $-C^4H_2-$
* $-C^5H(F)-$
* $-C^6H(CH_2CH_3)-$ (CH with an ethyl group)
* $-C^7H_3$ (End methyl)
2. Find Longest Chain:
* Straight through from left to right end: 7 carbons.
* Check branching at C6: Instead of ending at C7, go down the ethyl group ($CH_2CH_3$).
* Path: Left end ... C6 ... Ethyl end.
* Count: $1+1+1+1+1+1+2 = 8$ carbons?
* Let's count atoms:
* C1 (left Me)
* C2 (CH2)
* C3 (Quat C)
* C4 (CH2)
* C5 (CH-F)
* C6 (CH)
* C7/C8 (Ethyl group attached to C6).
* Yes, the chain continues into the ethyl group.
* Total length: 8 carbons. Parent: Octane.
3. Number the chain:
* Option A (Left to Right/Ethyl end):
* C1-C2: Left ethyl.
* C3: Quaternary C. Has two Methyl groups.
* C4: CH2.
* C5: CH. Has Fluoro.
* C6: CH. Has Methyl (the original C7 from the formula string becomes a substituent because the chain went down the ethyl).
* C7-C8: The ethyl group tail.
* Substituents: 3,3-dimethyl, 5-fluoro, 6-methyl.
* Locants: 3, 3, 5, 6.
* Option B (From Ethyl end/Right to Left):
* Start at the end of the ethyl group attached to C6.
* C1-C2: Ethyl tail.
* C3: CH (original C6). Has Methyl.
* C4: CH (original C5). Has Fluoro.
* C5: CH2.
* C6: Quaternary C. Has two Methyl groups.
* C7-C8: Left ethyl tail.
* Substituents: 3-methyl, 4-fluoro, 6,6-dimethyl.
* Locants: 3, 4, 6, 6.
* Compare Locant sets:
* Set A: 3, 3, 5, 6
* Set B: 3, 4, 6, 6
* First point of difference: 3 vs 3 (tie). Second point: 3 vs 4.
* 3 is lower than 4. So Set A is preferred.
* Numbering is Left-to-Right.
4. Assemble Name:
* Substituents: Fluoro, Methyl.
* Alphabetical: Fluoro before Methyl.
* Groups: 5-fluoro, 3,3,6-trimethyl (wait, C6 has a methyl substituent? Yes, the terminal CH3 of the original formula string).
* Let's re-verify the substituent at C6.
* Chain goes C5 -> C6 -> Ethyl Group.
* Original formula part: $CH(CH_2CH_3)CH_3$.
* C6 is the CH. Attached are: H, C5, Ethyl Group (in chain), and Methyl Group (substituent).
* So yes, there is a methyl at C6.
* So we have:
* 3,3-dimethyl (at C3)
* 5-fluoro (at C5)
* 6-methyl (at C6)
* Combine methyls: 3,3,6-trimethyl.
* Full Name: 5-fluoro-3,3,6-trimethyloctane.

i)
1. Identify the ring: Cyclohexane (6 carbons).
2. Identify the substituent: Ethyl group ($CH_2CH_3$).
3. Numbering: Only one substituent, so numbering isn't strictly necessary (it's implicitly position 1), but usually omitted for mono-substituted cycloalkanes.
4. Name: Ethylcyclohexane

j)
1. Identify the ring: Cyclopentane (5 carbons).
2. Identify substituents:
* Methyl group ($CH_3$) on the left.
* Isopropyl group ($CH(CH_3)_2$) on the right.
3. Number the ring:
* We need the lowest locants.
* Positions will be 1 and 3 regardless of direction (1,3-disubstituted).
* Tie-breaker: Alphabetical order.
* Substituents: Isopropyl vs Methyl.
* "I" comes before "M".
* So, Isopropyl gets position 1. Methyl gets position 3.
4. Name: 1-isopropyl-3-methylcyclopentane

──────────────────────────────────────

Final Answer:

a) 2,3-dimethylpentane
b) 2,3-dimethylbutane
c) 3,4-diethyl-2-methylhexane
d) 4-ethyl-2-methylhexane
e) 2-chloropentane
f) 4-ethyl-3,5-dimethylhexane
g) 5-bromo-4-ethyl-3-methyloctane
h) 5-fluoro-3,3,6-trimethyloctane
i) ethylcyclohexane
j) 1-isopropyl-3-methylcyclopentane
Parent Tip: Review the logic above to help your child master the concept of alkanes worksheet.
Print Download

How to use

Click Print to open a print-ready version directly in your browser, or use Download to save the file to your device. The ⭐ Answer button generates an AI answer key instantly - useful for teachers who need a quick reference. Need a different version? Our AI Worksheet Generator lets you create a custom worksheet on any topic in seconds.

(view all alkanes worksheet)

naming alkanes worksheet 1.pdf - Matthew McGann Name 2 Period ...
Sch 4u0 Unit Hydrocarbons Worksheet Alkanes - Fill and Sign ...
2 namingsimplehydrocarbons ws - Name Period Naming Alkanes ...
Free Printable Naming Alkanes Worksheets for Students
Naming Alkanes Worksheet #2 - YouTube
Solved Alkanes Worksheet 1. Name the following molecules a ...
Solved Naming Alkanes - Worksheet #1 Name the following | Chegg.com
Alkane Nomenclature Worksheet for 9th - 12th Grade | Lesson Planet
Worksheet Naming Alkanes
Naming Alkanes Worksheet #1