Worksheet for naming alkanes using IUPAC nomenclature.

Here are the IUPAC names for each of the hydrocarbons listed in the worksheet.

a)
1. Find the longest chain: The longest continuous carbon chain has 5 carbons (pentane).
2. Number the chain: Number from right to left to give the branches the lowest numbers (positions 2 and 3).
3. Identify substituents: There is a methyl group at position 2 and another at position 3.
4. Name: 2,3-dimethylpentane

b)
1. Find the longest chain: The longest chain is 4 carbons long (butane).
2. Number the chain: Numbering from either side gives methyl groups at positions 2 and 3.
3. Identify substituents: Two methyl groups.
4. Name: 2,3-dimethylbutane

c)
1. Find the longest chain: Trace the path carefully. The longest chain goes from the bottom-left ethyl group, up through the center, and over to the right. This chain is 7 carbons long (heptane).
* Path: $CH_3-CH_2$ (bottom) $\rightarrow CH \rightarrow CH \rightarrow CH(CH_3)_2$ (right end).
2. Number the chain: Start from the right side. This puts substituents at positions 3, 4, and 5. Starting from the bottom would put them at 3, 4, and 5 as well, but alphabetically "ethyl" comes before "methyl", so we want the lower number for ethyl if there's a tie? Actually, let's look closer.
* Right-to-Left numbering: C1-C2(methyl)-C3(central)-C4(central)-C5(ethyl)... wait.
* Let's re-trace the longest chain strictly.
* Option 1: Bottom ethyl to top ethyl: $2 + 1 + 1 + 1 + 2 = 7$ carbons. Substituents: Isopropyl group ($CH(CH_3)_2$) on one carbon, Methyl on another? No, the structure is complex.
* Let's identify the backbone:
* Central bond connects two CHs.
* Left CH is attached to an Ethyl ($CH_2CH_3$) and another Ethyl ($CH_2CH_3$). Wait, looking at image (c):
* Left side: A CH attached to an Ethyl (down) and an Ethyl (left).
* Right side: A CH attached to an Ethyl (up) and an Isopropyl group (right, $CH(CH_3)_2$).
* So the central bond is between two CHs.
* Longest chain search:
* From bottom-left ethyl end to top-right ethyl end: $2 (\text{ethyl}) + 1 (CH) + 1 (CH) + 2 (\text{ethyl}) = 6$ carbons.
* From bottom-left ethyl end to far-right isopropyl end: $2 (\text{ethyl}) + 1 (CH) + 1 (CH) + 1 (CH) + 1 (\text{methyl}) = 6$ carbons.
* From top-left ethyl end... same.
* Let's check the chain going from the far-right isopropyl methyl, through the isopropyl CH, through the central CHs, to the bottom-left ethyl.
* Chain: $CH_3-CH(CH_3)-CH(\text{with ethyl})-CH(\text{with ethyl})-CH_2-CH_3$.
* Length: $1+1+1+1+2 = 6$? No.
* Let's count atoms in the longest straight line visually.
* Start at the rightmost methyl of the isopropyl group: C1.
* Go to the CH of the isopropyl: C2.
* Go to the central CH attached to it: C3.
* Go to the other central CH: C4.
* Go down to the ethyl group: C5, C6.
* Total 6 carbons? Let's try going up to the top ethyl on the right.
* Start bottom left ethyl: C1, C2.
* Up to CH: C3.
* Across to CH: C4.
* Up to ethyl: C5, C6.
* It seems the longest chain is 6 carbons (hexane).
* Let's re-evaluate "longest chain".
* Left side: CH bonded to two ethyls.
* Right side: CH bonded to one ethyl and one isopropyl.
* Connection: The two CHs are bonded.
* Longest path: Start at a methyl of the isopropyl (right), go to isopropyl CH, go to central CH, go to other central CH, go to end of an ethyl group.
* Count: Methyl(1) - CH(2) - CH(3) - CH(4) - CH2(5) - CH3(6).
* So the parent is Hexane.
* Now identify substituents on this hexane chain.
* Numbering: We want lowest locants.
* If we start from the isopropyl end (right):
* C1: Methyl part of isopropyl.
* C2: CH of isopropyl. At C2, there is a Methyl substituent.
* C3: Central CH. Attached to it is an Ethyl group (the one pointing up).
* C4: Other Central CH. Attached to it is an Ethyl group (the one pointing left or down, whichever isn't in the main chain).
* C5-C6: The rest of the chain.
* So substituents are: 2-methyl, 3-ethyl, 4-ethyl.
* Combine ethyls: 3,4-diethyl.
* Alphabetical order: Ethyl before Methyl.
* Name: 3,4-diethyl-2-methylhexane.

d)
1. Find the longest chain: The horizontal chain has 5 carbons. However, if you start from the bottom ethyl group, go up, and go right, you also get 5 carbons. Let's look for longer.
* Bottom ethyl ($CH_3CH_2-$) to Right isopropyl end ($-CH(CH_3)_2$).
* Path: $CH_3-CH_2$ (bottom) $\rightarrow CH \rightarrow CH \rightarrow CH(CH_3)_2$.
* Count: $2 + 1 + 1 + 2 = 6$ carbons. This is longer than the horizontal 5.
* So the parent is Hexane.
2. Number the chain:
* Start from the right (isopropyl end) to give branches lower numbers.
* C1-C2: The isopropyl end (so C2 has a methyl).
* C3: The CH connected to the isopropyl. It has an Ethyl group attached (the horizontal left part $CH_3CH_2-$).
* C4: The CH connected to that. It has an Ethyl group attached (the vertical bottom part).
* C5-C6: The rest of the chain? Wait.
* Let's re-trace carefully.
* Structure:
* Central bond between two CHs.
* Left CH is attached to: Ethyl (left) and Ethyl (down).
* Right CH is attached to: Isopropyl (right). And... nothing else? No, it's $CH-CH(CH_3)_2$.
* Wait, the diagram shows:
$H_3C-CH_2$ (left) attached to a CH.
$H_3C-CH_2$ (down) attached to the SAME CH.
That CH is attached to another CH.
That second CH is attached to a $CH(CH_3)_2$ group? No, it looks like $CH-CH(CH_3)_2$ where the last part is an isopropyl group.
Actually, looking at (d):
Left part: A CH with an ethyl group (left) and an ethyl group (down).
Right part: That CH is bonded to a CH which is bonded to two methyls (an isopropyl group).
So, Longest Chain:
Start at end of one ethyl (2C) -> CH (1C) -> CH (1C) -> CH of isopropyl (1C) -> Methyl (1C).
Total: $2+1+1+1+1 = 6$ carbons. Parent: Hexane.
Numbering:
Start from the right (isopropyl side) to get substituents earlier.
C1: Methyl of isopropyl.
C2: CH of isopropyl. Has a Methyl substituent.
C3: The central CH (right one). Has no substituent? No, it's part of the chain.
C4: The central CH (left one). Has an Ethyl substituent (the one not in the chain).
C5-C6: The rest of the chain (the ethyl group we started counting from? No, we ended at C1).
Let's restart numbering from Right to Left properly.
Chain ends:
End A: Top-right methyl.
End B: Bottom-right methyl.
End C: Left ethyl end.
End D: Down ethyl end.
Path from End A to End C:
C1(Me)-C2(CH)-C3(CH)-C4(CH)-C5(CH2)-C6(CH3).
Substituents on this chain:
At C2: Methyl (the other part of the isopropyl).
At C4: Ethyl (the downward ethyl group).
Positions: 2, 4.
Name: 4-ethyl-2-methylhexane.

e)
1. Find the longest chain: 5 carbons (pentane).
2. Number the chain: Start from the left to give the chlorine the lowest number (position 2).
3. Identify substituents: Chloro group at position 2.
4. Name: 2-chloropentane

f)
1. Find the longest chain:
* Horizontal-ish path: $CH_3-CH_2$ (left) $\rightarrow CH \rightarrow CH \rightarrow CH_2-CH_3$ (right). That's 6 carbons.
* Let's check branches.
* Left CH has a Methyl (down).
* Right CH has an Isopropyl group (up-right, $CH(CH_3)_2$).
* Let's trace the longest path including the isopropyl.
* Start left ethyl end: C1-C2.
* C3: CH with methyl.
* C4: CH with isopropyl.
* From C4, go into isopropyl: C5(CH)-C6(CH3).
* Total length: $2+1+1+1+1 = 6$ carbons.
* Is there a longer one?
* Start right ethyl end: C1-C2.
* C3: CH with isopropyl.
* Into isopropyl: C4-C5.
* Back to C3, go left to C4(CH with methyl), then to ethyl C5-C6.
* Also 6 carbons.
* Let's pick the chain that gives more substituents or simpler names? No, just longest.
* Let's assume the horizontal backbone is the main chain for a moment: Hexane.
* Substituents: 3-methyl, 4-isopropyl?
* If we go *through* the isopropyl, the chain is still 6.
* Let's try to find a 7-carbon chain.
* Left ethyl (2) + CH(1) + CH(1) + Right ethyl (2) = 6.
* Left ethyl (2) + CH(1) + CH(1) + Isopropyl (2) = 6.
* So max length is 6.
* We have two 6-carbon chains.
* Chain 1: Straight across. Substituents: 3-methyl, 4-(1-methylethyl) i.e., isopropyl.
* Chain 2: From left ethyl, through center, up into isopropyl.
* Numbering from left:
* C1-C2 (ethyl).
* C3 (CH): has Methyl.
* C4 (CH): has Ethyl (the right-hand tail).
* C5 (CH of isopropyl): has Methyl.
* C6 (end of isopropyl).
* Substituents: 3-methyl, 4-ethyl, 5-methyl.
* Combined: 3,5-dimethyl-4-ethylhexane.
* Compare Chain 1 vs Chain 2.
* Chain 1 name: 4-isopropyl-3-methylhexane. (Isopropyl is complex).
* Chain 2 name: 4-ethyl-3,5-dimethylhexane. (Simple alkyl groups).
* IUPAC rule: If chains are equal length, choose the one with more substituents.
* Chain 1 has 2 substituents (methyl, isopropyl).
* Chain 2 has 3 substituents (methyl, ethyl, methyl).
* So Chain 2 is the correct parent chain.
* Numbering Chain 2:
* Left-to-Right: 3,5-dimethyl-4-ethyl. Locants: 3,4,5.
* Right-to-Left (starting from isopropyl end):
* C1-C2 (isopropyl part).
* C3 (CH): has Methyl.
* C4 (CH): has Ethyl.
* C5 (CH): has Methyl.
* C6-C7? No, C6 is end of ethyl.
* Locants: 3,4,5.
* Tie in locants. Use alphabetical order to decide numbering direction?
* Substituents: Ethyl, Dimethyl.
* Alphabetical: Ethyl vs Methyl. E comes before M.
* We want the lower number for Ethyl.
* Left-to-Right: Ethyl is at 4.
* Right-to-Left: Ethyl is at 4.
* It's a symmetrical situation regarding the ethyl position.
* Let's check the name construction: 4-ethyl-3,5-dimethylhexane.

g)
1. Find the longest chain:
* Main horizontal zigzag: 8 carbons? Let's count.
* Left ethyl (2) + CH + CH + CH + Propyl (3)?
* Let's trace:
* Far left: Ethyl group ($CH_3CH_2-$).
* Attached to CH (with Methyl down).
* Attached to CH (with Ethyl up).
* Attached to CH (with Br down).
* Attached to Propyl ($CH_2CH_2CH_3$).
* Longest chain path: Left end to Right end.
* Count: $2 (\text{left}) + 1 + 1 + 1 + 3 (\text{right}) = 8$ carbons.
* Parent: Octane.
2. Number the chain:
* Left-to-Right:
* C1-C2: Ethyl part.
* C3: CH with Methyl.
* C4: CH with Ethyl.
* C5: CH with Bromo.
* C6-C8: Propyl part.
* Substituents at: 3, 4, 5.
* Right-to-Left:
* C1-C3: Propyl part.
* C4: CH with Bromo.
* C5: CH with Ethyl.
* C6: CH with Methyl.
* Substituents at: 4, 5, 6.
* Lower locants win: 3,4,5 is better than 4,5,6. So number from Left.
3. Assemble Name:
* Substituents: Bromo, Ethyl, Methyl.
* Alphabetical order: Bromo, Ethyl, Methyl.
* Positions: 5-Bromo, 4-Ethyl, 3-Methyl.
* Name: 5-bromo-4-ethyl-3-methyloctane.

h)
Formula: $CH_3CH_2C(CH_3)_2CH_2CH(F)CH(CH_2CH_3)CH_3$
Let's expand the structure to find the longest chain.
1. Expand:
* $C^1H_3-C^2H_2-$
* $-C^3(CH_3)_2-$ (Quaternary carbon with two methyls)
* $-C^4H_2-$
* $-C^5H(F)-$
* $-C^6H(CH_2CH_3)-$ (CH with an ethyl group)
* $-C^7H_3$ (End methyl)
2. Find Longest Chain:
* Straight through from left to right end: 7 carbons.
* Check branching at C6: Instead of ending at C7, go down the ethyl group ($CH_2CH_3$).
* Path: Left end ... C6 ... Ethyl end.
* Count: $1+1+1+1+1+1+2 = 8$ carbons?
* Let's count atoms:
* C1 (left Me)
* C2 (CH2)
* C3 (Quat C)
* C4 (CH2)
* C5 (CH-F)
* C6 (CH)
* C7/C8 (Ethyl group attached to C6).
* Yes, the chain continues into the ethyl group.
* Total length: 8 carbons. Parent: Octane.
3. Number the chain:
* Option A (Left to Right/Ethyl end):
* C1-C2: Left ethyl.
* C3: Quaternary C. Has two Methyl groups.
* C4: CH2.
* C5: CH. Has Fluoro.
* C6: CH. Has Methyl (the original C7 from the formula string becomes a substituent because the chain went down the ethyl).
* C7-C8: The ethyl group tail.
* Substituents: 3,3-dimethyl, 5-fluoro, 6-methyl.
* Locants: 3, 3, 5, 6.
* Option B (From Ethyl end/Right to Left):
* Start at the end of the ethyl group attached to C6.
* C1-C2: Ethyl tail.
* C3: CH (original C6). Has Methyl.
* C4: CH (original C5). Has Fluoro.
* C5: CH2.
* C6: Quaternary C. Has two Methyl groups.
* C7-C8: Left ethyl tail.
* Substituents: 3-methyl, 4-fluoro, 6,6-dimethyl.
* Locants: 3, 4, 6, 6.
* Compare Locant sets:
* Set A: 3, 3, 5, 6
* Set B: 3, 4, 6, 6
* First point of difference: 3 vs 3 (tie). Second point: 3 vs 4.
* 3 is lower than 4. So Set A is preferred.
* Numbering is Left-to-Right.
4. Assemble Name:
* Substituents: Fluoro, Methyl.
* Alphabetical: Fluoro before Methyl.
* Groups: 5-fluoro, 3,3,6-trimethyl (wait, C6 has a methyl substituent? Yes, the terminal CH3 of the original formula string).
* Let's re-verify the substituent at C6.
* Chain goes C5 -> C6 -> Ethyl Group.
* Original formula part: $CH(CH_2CH_3)CH_3$.
* C6 is the CH. Attached are: H, C5, Ethyl Group (in chain), and Methyl Group (substituent).
* So yes, there is a methyl at C6.
* So we have:
* 3,3-dimethyl (at C3)
* 5-fluoro (at C5)
* 6-methyl (at C6)
* Combine methyls: 3,3,6-trimethyl.
* Full Name: 5-fluoro-3,3,6-trimethyloctane.

i)
1. Identify the ring: Cyclohexane (6 carbons).
2. Identify the substituent: Ethyl group ($CH_2CH_3$).
3. Numbering: Only one substituent, so numbering isn't strictly necessary (it's implicitly position 1), but usually omitted for mono-substituted cycloalkanes.
4. Name: Ethylcyclohexane

j)
1. Identify the ring: Cyclopentane (5 carbons).
2. Identify substituents:
* Methyl group ($CH_3$) on the left.
* Isopropyl group ($CH(CH_3)_2$) on the right.
3. Number the ring:
* We need the lowest locants.
* Positions will be 1 and 3 regardless of direction (1,3-disubstituted).
* Tie-breaker: Alphabetical order.
* Substituents: Isopropyl vs Methyl.
* "I" comes before "M".
* So, Isopropyl gets position 1. Methyl gets position 3.
4. Name: 1-isopropyl-3-methylcyclopentane

──────────────────────────────────────

Final Answer:

a) 2,3-dimethylpentane
b) 2,3-dimethylbutane
c) 3,4-diethyl-2-methylhexane
d) 4-ethyl-2-methylhexane
e) 2-chloropentane
f) 4-ethyl-3,5-dimethylhexane
g) 5-bromo-4-ethyl-3-methyloctane
h) 5-fluoro-3,3,6-trimethyloctane
i) ethylcyclohexane
j) 1-isopropyl-3-methylcyclopentane