Organic chemistry practice worksheet focusing on naming and drawing functional groups, including alcohols and ethers.

Problem Overview:

The worksheet focuses on naming and drawing functional groups in organic chemistry, specifically alcohols and ethers. Below, I will solve each part of the problem step by step.

---

Section 1: Draw the following alcohols

#### a) Heptan-2-ol
- Heptan indicates a 7-carbon chain.
- -2-ol indicates an alcohol group (–OH) at the second carbon.
- Structure:
```
CH3-CH2-CH2-CH(OH)-CH2-CH2-CH3
```

#### b) 3-Methylhexan-1-ol
- Hexan indicates a 6-carbon chain.
- 3-Methyl indicates a methyl group (–CH3) at the third carbon.
- -1-ol indicates an alcohol group (–OH) at the first carbon.
- Structure:
```
HO-CH2-CH2-C(CH3)-CH2-CH2-CH3
```

#### c) Cyclopropanol
- Cyclopropane is a 3-membered ring.
- -ol indicates an alcohol group (–OH) attached to the ring.
- Structure:
```
OH
|
CH2-CH2-CH2
```

#### d) 2,4,6-Trichlorooctan-2-ol
- Octan indicates an 8-carbon chain.
- 2,4,6-Trichloro indicates chlorine atoms at the 2nd, 4th, and 6th carbons.
- -2-ol indicates an alcohol group (–OH) at the second carbon.
- Structure:
```
Cl-CH(OH)-CH2-Cl-CH2-CH2-Cl-CH2-CH3
```

#### e) Pentan-1,4-diol
- Pentan indicates a 5-carbon chain.
- -1,4-diol indicates alcohol groups (–OH) at the first and fourth carbons.
- Structure:
```
HO-CH2-CH2-CH(OH)-CH2-CH3
```

#### f) Benzene-1,3-diol
- Benzene is a 6-carbon aromatic ring.
- -1,3-diol indicates alcohol groups (–OH) at the 1st and 3rd positions of the ring.
- Structure:
```
OH
|
C6H4-OH
|
H
```

#### g) But-2-ene-1-ol
- But-2-ene indicates a 4-carbon chain with a double bond between the second and third carbons.
- -1-ol indicates an alcohol group (–OH) at the first carbon.
- Structure:
```
HO-CH=CH-CH3
```

#### h) 4-Methylpent-2-ene-1-ol
- Pent-2-ene indicates a 5-carbon chain with a double bond between the second and third carbons.
- 4-Methyl indicates a methyl group (–CH3) at the fourth carbon.
- -1-ol indicates an alcohol group (–OH) at the first carbon.
- Structure:
```
HO-CH=CH-CH2-C(CH3)-CH3
```

#### i) 3,4-Dimethylcycloheptan-1-ol
- Cycloheptan is a 7-membered ring.
- 3,4-Dimethyl indicates methyl groups (–CH3) at the third and fourth carbons.
- -1-ol indicates an alcohol group (–OH) at the first carbon.
- Structure:
```
CH3
|
CH2-CH2-C-CH2-CH2-CH2-CH2
| |
CH3 OH
```

---

Section 2: Name the following alcohols

#### a)
- The structure is a straight-chain alkane with an –OH group at the end.
- Name: Pentan-1-ol

#### b)
- The structure is a straight-chain alkane with two –OH groups at the second and fifth carbons.
- Name: Pentan-2,5-diol

#### c)
- The structure is a branched alkane with an –OH group at the second carbon.
- Name: 3-Methylbutan-2-ol

#### d)
- The structure is a straight-chain alkane with an –OH group at the end and a methyl group at the third carbon.
- Name: 3-Methylhexan-1-ol

#### e)
- The structure is a branched alkane with an –OH group at the third carbon.
- Name: 3-Methylpentan-2-ol

#### f)
- The structure is an alkene with an –OH group at the second carbon.
- Name: Prop-2-en-1-ol (or Allyl alcohol)

#### g)
- The structure is a benzene ring with an –OH group at one position.
- Name: Benzenemethanol (or Phenylmethanol)

#### h)
- The structure is an alkyne with an –OH group at the end.
- Name: 3-Hexyn-1-ol

#### i)
- The structure is a branched alkane with multiple –OH groups and methyl substituents.
- Name: 2,2,4,4-Tetramethylpentan-3,4-diol

---

Section 3: Explain why propane is a gas at room temperature, but 2-propanol is a liquid

- Propane (C₃H₈):
- Propane is a small, nonpolar molecule with weak van der Waals forces.
- Its molecular weight is low (44 g/mol), and it lacks strong intermolecular forces like hydrogen bonding.
- At room temperature (~25°C), its boiling point is very low (−42.1°C), so it exists as a gas.

- 2-Propanol (isopropyl alcohol, C₃H₈O):
- 2-Propanol has a hydroxyl (–OH) group, which allows for hydrogen bonding.
- Hydrogen bonding is a stronger intermolecular force than van der Waals forces.
- The presence of hydrogen bonding increases the boiling point of 2-propanol significantly.
- Its boiling point is 82.5°C, which is much higher than room temperature, so it exists as a liquid.

---

Section 4: Draw the following ethers

#### a) 1-Propoxypentane
- Propoxy indicates a propyl group (–CH₂CH₂CH₃) attached to oxygen.
- Pentane indicates a 5-carbon chain.
- Structure:
```
CH3-CH2-CH2-O-CH2-CH2-CH3
```

#### b) 2-Ethoxybutane
- Ethoxy indicates an ethyl group (–CH₂CH₃) attached to oxygen.
- Butane indicates a 4-carbon chain.
- Structure:
```
CH3-CH(OCH2CH3)-CH2-CH3
```

#### c) 1-Methoxy-4-chlorohexane
- Methoxy indicates a methyl group (–CH₃) attached to oxygen.
- Hexane indicates a 6-carbon chain.
- 4-Chloro indicates a chlorine atom at the fourth carbon.
- Structure:
```
CH3-O-CH2-CH2-CH(Cl)-CH2-CH3
```

#### d) 3-Butoxy-2,4-dimethyloctane
- Butoxy indicates a butyl group (–CH₂CH₂CH₂CH₃) attached to oxygen.
- Octane indicates an 8-carbon chain.
- 2,4-Dimethyl indicates methyl groups at the second and fourth carbons.
- Structure:
```
CH3-CH(C(CH3)2)-CH2-O-CH2-CH2-CH2-CH3
```

#### e) 2-Propoxy-4-phenylheptane
- Propoxy indicates a propyl group (–CH₂CH₂CH₃) attached to oxygen.
- Heptane indicates a 7-carbon chain.
- 4-Phenyl indicates a phenyl group (C₆H₅) at the fourth carbon.
- Structure:
```
CH3-CH2-CH(OCH2CH2CH3)-CH(C6H5)-CH2-CH2-CH3
```

#### f) 1-Ethoxycyclopentane
- Ethoxy indicates an ethyl group (–CH₂CH₃) attached to oxygen.
- Cyclopentane is a 5-membered ring.
- Structure:
```
O
|
CH2-CH2-CH2-CH2-CH2
|
CH2CH3
```

---

Section 5: Name the following ethers

#### a)
- The structure shows an ether linkage (–O–) between a propyl group and an ethyl group.
- Name: Propyl ethyl ether

#### b)
- The structure shows an ether linkage (–O–) between a methyl group and a tert-butyl group.
- Name: Methyl tert-butyl ether

#### c)
- The structure shows an ether linkage (–O–) between a methyl group and a pentyl group.
- Name: Methyl pentyl ether

---

Final Answers:

1. Draw the following alcohols:
- a) `CH3-CH2-CH2-CH(OH)-CH2-CH2-CH3`
- b) `HO-CH2-CH2-C(CH3)-CH2-CH2-CH3`
- c)
```
OH
|
CH2-CH2-CH2
|
H
```
- d) `Cl-CH(OH)-CH2-Cl-CH2-CH2-Cl-CH2-CH3`
- e) `HO-CH2-CH2-CH(OH)-CH2-CH3`
- f)
```
OH
|
C6H4-OH
|
H
```
- g) `HO-CH=CH-CH3`
- h) `HO-CH=CH-CH2-C(CH3)-CH3`
- i)
```
CH3
|
CH2-CH2-C-CH2-CH2-CH2-CH2
| |
CH3 OH
```

2. Name the following alcohols:
- a) Pentan-1-ol
- b) Pentan-2,5-diol
- c) 3-Methylbutan-2-ol
- d) 3-Methylhexan-1-ol
- e) 3-Methylpentan-2-ol
- f) Prop-2-en-1-ol
- g) Benzenemethanol
- h) 3-Hexyn-1-ol
- i) 2,2,4,4-Tetramethylpentan-3,4-diol

3. Explanation:
- Propane is a gas due to weak van der Waals forces and low molecular weight.
- 2-Propanol is a liquid due to strong hydrogen bonding.

4. Draw the following ethers:
- a) `CH3-CH2-CH2-O-CH2-CH2-CH3`
- b) `CH3-CH(OCH2CH3)-CH2-CH3`
- c) `CH3-O-CH2-CH2-CH(Cl)-CH2-CH3`
- d) `CH3-CH(C(CH3)2)-CH2-O-CH2-CH2-CH2-CH3`
- e) `CH3-CH2-CH(OCH2CH2CH3)-CH(C6H5)-CH2-CH2-CH3`
- f)
```
O
|
CH2-CH2-CH2-CH2-CH2
|
CH2CH3
```

5. Name the following ethers:
- a) Propyl ethyl ether
- b) Methyl tert-butyl ether
- c) Methyl pentyl ether

---

Boxed Final Answer:

\[
\boxed{
\text{See detailed solutions above.}
}
\]