50+ alkanes cycloalkanes and functional groups worksheets for 11th ... - Free Printable

Problem Analysis:

The task involves naming organic compounds using IUPAC nomenclature. The provided images show various alkane and cycloalkane structures, and the goal is to identify their correct names based on IUPAC rules.

Solution:

#### Question 1:
Structure:
```
CH3-CH2-CH2-CH2-CH(CH2-CH2-CH3)-CH2-CH3
```
- This is a straight-chain alkane with a substituent.
- The longest carbon chain has 9 carbons, so the base name is "nonane."
- The substituent is an ethyl group (CH2-CH3) located at the 4th carbon.
- Therefore, the name is 4-ethylnonane.

Correct Answer:
- A. 4-ethylnonane

---

#### Question 2:
Structure:
```
Cyclohexane ring with a tert-butyl group attached.
```
- The parent structure is a cyclohexane ring.
- The substituent is a tert-butyl group (CH3)3C-, which is attached to the ring.
- The correct name is tert-butylocyclohexane.

Correct Answer:
- B. tert-butylocyclohexane

---

#### Question 3:
Structure:
```
Heptane chain with methyl groups at positions 2, 3, 4, and 5.
```
- The longest carbon chain has 7 carbons, so the base name is "heptane."
- There are four methyl groups (CH3) at positions 2, 3, 4, and 5.
- The correct name is 2,3,4,5-tetramethylheptane.

Correct Answer:
- C. 2,3,4,5-tetramethylheptane

---

#### Question 4:
Structure:
```
Cyclopentane ring with an octyl group (8-carbon chain) attached.
```
- The parent structure is a cyclopentane ring.
- The substituent is an octyl group (CH3-(CH2)6-CH2-) attached to the ring.
- The correct name is 4-octylcyclopentane.

Correct Answer:
- C. 4-octylcyclopentane

---

Final Answers:

1. A. 4-ethylnonane
2. B. tert-butylocyclohexane
3. C. 2,3,4,5-tetramethylheptane
4. C. 4-octylcyclopentane

Boxed Final Answer:
\[
\boxed{A, B, C, C}
\]